C25H26NO7P — CID 57155509
diphenoxyphosphoryl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-prop-2-enyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 57155509) has the molecular formula C25H26NO7P and a molecular weight of 483.46 g/mol. Its IUPAC name is diphenoxyphosphoryl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-prop-2-enyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | diphenoxyphosphoryl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-prop-2-enyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 57155509 |
| Molecular Formula | C25H26NO7P |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | diphenoxyphosphoryl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-prop-2-enyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCC1=C(C(=O)OP(=O)(Oc2ccccc2)Oc2ccccc2)N2C(=O)[C@H]([C@@H](C)O)[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C25H26NO7P/c1-4-11-20-16(2)22-21(17(3)27)24(28)26(22)23(20)25(29)33-34(30,31-18-12-7-5-8-13-18)32-19-14-9-6-10-15-19/h4-10,12-17,21-22,27H,1,11H2,2-3H3/t16-,17-,21-,22+/m1/s1 |
| InChIKey | OXEZBNKDRVVDBS-ZYOFANERSA-N |
| XLogP | 4.48 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|