C30H29N2O12P — CID 89456492
2-(4-nitrophenyl)ethyl (4R,5S,6S)-3-bis(phenylperoxy)phosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 89456492) has the molecular formula C30H29N2O12P and a molecular weight of 640.54 g/mol. Its IUPAC name is 2-(4-nitrophenyl)ethyl (4R,5S,6S)-3-bis(phenylperoxy)phosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | 2-(4-nitrophenyl)ethyl (4R,5S,6S)-3-bis(phenylperoxy)phosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 89456492 |
| Molecular Formula | C30H29N2O12P |
| Molecular Weight | 640.54 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | 2-(4-nitrophenyl)ethyl (4R,5S,6S)-3-bis(phenylperoxy)phosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCCc3ccc([N+](=O)[O-])cc3)=C(OP(=O)(OOc3ccccc3)OOc3ccccc3)[C@H](C)[C@@H]12 |
| InChI | InChI=1S/C30H29N2O12P/c1-19-26-25(20(2)33)29(34)31(26)27(30(35)39-18-17-21-13-15-22(16-14-21)32(36)37)28(19)42-45(38,43-40-23-9-5-3-6-10-23)44-41-24-11-7-4-8-12-24/h3-16,19-20,25-26,33H,17-18H2,1-2H3/t19-,20-,25-,26+/m1/s1 |
| InChIKey | BNLSKOBSGJEVCO-JHESGUABSA-N |
| XLogP | 4.90 |
| TPSA | 173.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|