C20H21ClN2O9 — CID 139703770
(4-nitrophenyl)methyl (4R,5R,6S)-3-(2-chloroethoxycarbonyloxy)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 139703770) has the molecular formula C20H21ClN2O9 and a molecular weight of 468.85 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R,5R,6S)-3-(2-chloroethoxycarbonyloxy)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4R,5R,6S)-3-(2-chloroethoxycarbonyloxy)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139703770 |
| Molecular Formula | C20H21ClN2O9 |
| Molecular Weight | 468.85 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | (4-nitrophenyl)methyl (4R,5R,6S)-3-(2-chloroethoxycarbonyloxy)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(OC(=O)OCCCl)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C20H21ClN2O9/c1-10-15-14(11(2)24)18(25)22(15)16(17(10)32-20(27)30-8-7-21)19(26)31-9-12-3-5-13(6-4-12)23(28)29/h3-6,10-11,14-15,24H,7-9H2,1-2H3/t10-,11-,14-,15-/m1/s1 |
| InChIKey | UTMJBHBRVPBYBH-YIKOMLBNSA-N |
| XLogP | 2.10 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.85 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|