C27H30FN3O10S2 — CID 42598127
(4-nitrophenyl)methyl (4R,5S,6S)-3-[1-[(4-fluorophenyl)methyl]azetidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate;sulfuric acid (PubChem CID 42598127) has the molecular formula C27H30FN3O10S2 and a molecular weight of 639.68 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R,5S,6S)-3-[1-[(4-fluorophenyl)methyl]azetidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate;sulfuric acid.
| Compound Name | (4-nitrophenyl)methyl (4R,5S,6S)-3-[1-[(4-fluorophenyl)methyl]azetidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 42598127 |
| Molecular Formula | C27H30FN3O10S2 |
| Molecular Weight | 639.68 g/mol |
| Exact Mass | 639.14 |
| IUPAC Name | (4-nitrophenyl)methyl (4R,5S,6S)-3-[1-[(4-fluorophenyl)methyl]azetidin-3-yl]sulfanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate;sulfuric acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(SC3CN(Cc4ccc(F)cc4)C3)[C@H](C)[C@H]12.O=S(=O)(O)O |
| InChI | InChI=1S/C27H28FN3O6S.H2O4S/c1-15-23-22(16(2)32)26(33)30(23)24(27(34)37-14-18-5-9-20(10-6-18)31(35)36)25(15)38-21-12-29(13-21)11-17-3-7-19(28)8-4-17;1-5(2,3)4/h3-10,15-16,21-23,32H,11-14H2,1-2H3;(H2,1,2,3,4)/t15-,16-,22-,23-;/m1./s1 |
| InChIKey | QUTLGUAGHYKIHR-NUVDOEAFSA-N |
| XLogP | 2.81 |
| TPSA | 187.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|