C24H26N4O6S2 — CID 57121591
(4-nitrophenyl)methyl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-[(2-methyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-6-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 57121591) has the molecular formula C24H26N4O6S2 and a molecular weight of 530.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-[(2-methyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-6-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-[(2-methyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-6-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 57121591 |
| Molecular Formula | C24H26N4O6S2 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | (4-nitrophenyl)methyl (4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-[(2-methyl-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-6-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | Cc1cn2c(n1)SCC(SC1=C(C(=O)OCc3ccc([N+](=O)[O-])cc3)N3C(=O)[C@H]([C@@H](C)O)[C@H]3[C@H]1C)C2 |
| InChI | InChI=1S/C24H26N4O6S2/c1-12-8-26-9-17(11-35-24(26)25-12)36-21-13(2)19-18(14(3)29)22(30)27(19)20(21)23(31)34-10-15-4-6-16(7-5-15)28(32)33/h4-8,13-14,17-19,29H,9-11H2,1-3H3/t13-,14-,17?,18-,19-/m1/s1 |
| InChIKey | XWGKNBTWYGYTCT-GWCJPZCQSA-N |
| XLogP | 3.12 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|