C18H17F3N2O9S — CID 10625006
(4-nitrophenyl)methyl (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 10625006) has the molecular formula C18H17F3N2O9S and a molecular weight of 494.40 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 10625006 |
| Molecular Formula | C18H17F3N2O9S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 494.06 |
| IUPAC Name | (4-nitrophenyl)methyl (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(trifluoromethylsulfonyloxy)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(OS(=O)(=O)C(F)(F)F)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C18H17F3N2O9S/c1-8-13-12(9(2)24)16(25)22(13)14(15(8)32-33(29,30)18(19,20)21)17(26)31-7-10-3-5-11(6-4-10)23(27)28/h3-6,8-9,12-13,24H,7H2,1-2H3/t8-,9-,12-,13-/m1/s1 |
| InChIKey | IWRZEHCVPRPEPY-NRMKKVEVSA-N |
| XLogP | 1.57 |
| TPSA | 153.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|