C28H31N3O9S — CID 22863227
(4-nitrophenyl)methyl (5R)-3-[2-(diethylcarbamoyl)phenyl]sulfonyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 22863227) has the molecular formula C28H31N3O9S and a molecular weight of 585.64 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R)-3-[2-(diethylcarbamoyl)phenyl]sulfonyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R)-3-[2-(diethylcarbamoyl)phenyl]sulfonyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22863227 |
| Molecular Formula | C28H31N3O9S |
| Molecular Weight | 585.64 g/mol |
| Exact Mass | 585.18 |
| IUPAC Name | (4-nitrophenyl)methyl (5R)-3-[2-(diethylcarbamoyl)phenyl]sulfonyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCN(CC)C(=O)c1ccccc1S(=O)(=O)C1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)C(C(C)O)[C@@H]2C1C |
| InChI | InChI=1S/C28H31N3O9S/c1-5-29(6-2)26(33)20-9-7-8-10-21(20)41(38,39)25-16(3)23-22(17(4)32)27(34)30(23)24(25)28(35)40-15-18-11-13-19(14-12-18)31(36)37/h7-14,16-17,22-23,32H,5-6,15H2,1-4H3/t16?,17?,22?,23-/m0/s1 |
| InChIKey | JXNRDONACBCGKH-MFVBDYKBSA-N |
| XLogP | 2.66 |
| TPSA | 164.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|