C25H25N4O7S+ — CID 90918449
(4-nitrophenyl)methyl (4S,5R,6S)-3-(7-acetyl-6-methylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 90918449) has the molecular formula C25H25N4O7S+ and a molecular weight of 525.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4S,5R,6S)-3-(7-acetyl-6-methylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4S,5R,6S)-3-(7-acetyl-6-methylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 90918449 |
| Molecular Formula | C25H25N4O7S+ |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | (4-nitrophenyl)methyl (4S,5R,6S)-3-(7-acetyl-6-methylimidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=O)c1c2sc(C3=C(C(=O)OCc4ccc([N+](=O)[O-])cc4)N4C(=O)[C@H]([C@@H](C)O)[C@H]4[C@H]3C)c[n+]2cn1C |
| InChI | InChI=1S/C25H25N4O7S/c1-12-18(17-9-27-11-26(4)21(14(3)31)24(27)37-17)22(28-20(12)19(13(2)30)23(28)32)25(33)36-10-15-5-7-16(8-6-15)29(34)35/h5-9,11-13,19-20,30H,10H2,1-4H3/q+1/t12-,13+,19+,20+/m0/s1 |
| InChIKey | NYDIPHNFEKNYGK-FTMMXZFXSA-N |
| XLogP | 2.25 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|