C28H25N4O6S2+ — CID 90707542
(4-nitrophenyl)methyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(7-phenylsulfanyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 90707542) has the molecular formula C28H25N4O6S2+ and a molecular weight of 577.66 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(7-phenylsulfanyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(7-phenylsulfanyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 90707542 |
| Molecular Formula | C28H25N4O6S2+ |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | (4-nitrophenyl)methyl (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-(7-phenylsulfanyl-6H-imidazo[5,1-b][1,3]thiazol-4-ium-2-yl)-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(c3c[n+]4c[nH]c(Sc5ccccc5)c4s3)[C@H](C)[C@H]12 |
| InChI | InChI=1S/C28H24N4O6S2/c1-15-21(20-12-30-14-29-25(27(30)40-20)39-19-6-4-3-5-7-19)24(31-23(15)22(16(2)33)26(31)34)28(35)38-13-17-8-10-18(11-9-17)32(36)37/h3-12,14-16,22-23,33H,13H2,1-2H3/p+1/t15-,16+,22+,23+/m0/s1 |
| InChIKey | RFTDVMGAWHPJDO-JXULPDFHSA-O |
| XLogP | 4.19 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|