C29H27N2O10P — CID 66658771
(4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 66658771) has the molecular formula C29H27N2O10P and a molecular weight of 594.51 g/mol. Its IUPAC name is (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 66658771 |
| Molecular Formula | C29H27N2O10P |
| Molecular Weight | 594.51 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | (4R,5R,6S)-3-diphenoxyphosphoryloxy-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(OP(=O)(Oc3ccccc3)Oc3ccccc3)[C@](C)(Cc3ccc([N+](=O)[O-])cc3)[C@@H]12 |
| InChI | InChI=1S/C29H27N2O10P/c1-18(32)23-25-29(2,17-19-13-15-20(16-14-19)31(36)37)26(24(28(34)35)30(25)27(23)33)41-42(38,39-21-9-5-3-6-10-21)40-22-11-7-4-8-12-22/h3-16,18,23,25,32H,17H2,1-2H3,(H,34,35)/t18-,23-,25-,29-/m1/s1 |
| InChIKey | FBBMZOLKXAIGEI-BWGZFRQBSA-N |
| XLogP | 4.94 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|