C19H22N2O7S — CID 70003877
(4R,5S,6S)-6-(1-hydroxyethyl)-3-(methoxymethylsulfanyl)-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 70003877) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is (4R,5S,6S)-6-(1-hydroxyethyl)-3-(methoxymethylsulfanyl)-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4R,5S,6S)-6-(1-hydroxyethyl)-3-(methoxymethylsulfanyl)-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 70003877 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | (4R,5S,6S)-6-(1-hydroxyethyl)-3-(methoxymethylsulfanyl)-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | COCSC1=C(C(=O)O)N2C(=O)[C@H](C(C)O)[C@H]2[C@@]1(C)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22N2O7S/c1-10(22)13-15-19(2,8-11-4-6-12(7-5-11)21(26)27)16(29-9-28-3)14(18(24)25)20(15)17(13)23/h4-7,10,13,15,22H,8-9H2,1-3H3,(H,24,25)/t10?,13-,15+,19-/m1/s1 |
| InChIKey | XMKGQDZIFZHWNM-BFANGUNFSA-N |
| XLogP | 2.00 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|