C24H24N4O8S3 — CID 154428921
(4S,5R,6S)-3-[5,7-bis(methylsulfinyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154428921) has the molecular formula C24H24N4O8S3 and a molecular weight of 592.68 g/mol. Its IUPAC name is (4S,5R,6S)-3-[5,7-bis(methylsulfinyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-3-[5,7-bis(methylsulfinyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154428921 |
| Molecular Formula | C24H24N4O8S3 |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | (4S,5R,6S)-3-[5,7-bis(methylsulfinyl)imidazo[5,1-b][1,3]thiazol-2-yl]-6-[(1R)-1-hydroxyethyl]-4-methyl-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(c3cn4c(S(C)=O)nc(S(C)=O)c4s3)[C@](C)(Cc3ccc([N+](=O)[O-])cc3)[C@@H]12 |
| InChI | InChI=1S/C24H24N4O8S3/c1-11(29)15-18-24(2,9-12-5-7-13(8-6-12)28(33)34)16(17(22(31)32)27(18)20(15)30)14-10-26-21(37-14)19(38(3)35)25-23(26)39(4)36/h5-8,10-11,15,18,29H,9H2,1-4H3,(H,31,32)/t11-,15-,18-,24+,38?,39?/m1/s1 |
| InChIKey | KYXVXQIYTBKPMT-SWLFOIEHSA-N |
| XLogP | 2.04 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|