C23H22N4O6S2 — CID 154428887
(4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(5-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 154428887) has the molecular formula C23H22N4O6S2 and a molecular weight of 514.59 g/mol. Its IUPAC name is (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(5-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(5-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154428887 |
| Molecular Formula | C23H22N4O6S2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (4S,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-(5-methylsulfanylimidazo[5,1-b][1,3]thiazol-2-yl)-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | CSc1ncc2sc(C3=C(C(=O)O)N4C(=O)[C@H]([C@@H](C)O)[C@@H]4[C@@]3(C)Cc3ccc([N+](=O)[O-])cc3)cn12 |
| InChI | InChI=1S/C23H22N4O6S2/c1-11(28)16-19-23(2,8-12-4-6-13(7-5-12)27(32)33)17(18(21(30)31)26(19)20(16)29)14-10-25-15(35-14)9-24-22(25)34-3/h4-7,9-11,16,19,28H,8H2,1-3H3,(H,30,31)/t11-,16-,19-,23+/m1/s1 |
| InChIKey | HRPCWYOUZKCMSQ-HZFXOQTPSA-N |
| XLogP | 3.29 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|