C19H16N4O8S2 — CID 88765783
(5R,6R)-6-[(1S)-1-hydroxyethyl]-4-[(4-nitrophenyl)methyl]-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 88765783) has the molecular formula C19H16N4O8S2 and a molecular weight of 492.49 g/mol. Its IUPAC name is (5R,6R)-6-[(1S)-1-hydroxyethyl]-4-[(4-nitrophenyl)methyl]-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6R)-6-[(1S)-1-hydroxyethyl]-4-[(4-nitrophenyl)methyl]-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88765783 |
| Molecular Formula | C19H16N4O8S2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | (5R,6R)-6-[(1S)-1-hydroxyethyl]-4-[(4-nitrophenyl)methyl]-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@H](O)[C@@H]1C(=O)N2C(C(=O)O)=C(Sc3ncc([N+](=O)[O-])s3)C(Cc3ccc([N+](=O)[O-])cc3)[C@@H]12 |
| InChI | InChI=1S/C19H16N4O8S2/c1-8(24)13-14-11(6-9-2-4-10(5-3-9)22(28)29)16(15(18(26)27)21(14)17(13)25)33-19-20-7-12(32-19)23(30)31/h2-5,7-8,11,13-14,24H,6H2,1H3,(H,26,27)/t8-,11?,13-,14-/m0/s1 |
| InChIKey | JQPKETGBRGNBHJ-ASLIMQLRSA-N |
| XLogP | 2.43 |
| TPSA | 177.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|