C19H16N4O11S3 — CID 154310008
(4-nitrophenyl)methyl (5R,6R)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154310008) has the molecular formula C19H16N4O11S3 and a molecular weight of 572.56 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6R)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6R)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154310008 |
| Molecular Formula | C19H16N4O11S3 |
| Molecular Weight | 572.56 g/mol |
| Exact Mass | 572.00 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6R)-3-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-7-oxo-6-[(1S)-1-sulfooxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C[C@H](OS(=O)(=O)O)[C@@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(Sc3ncc([N+](=O)[O-])s3)C[C@H]12 |
| InChI | InChI=1S/C19H16N4O11S3/c1-9(34-37(30,31)32)15-12-6-13(35-19-20-7-14(36-19)23(28)29)16(21(12)17(15)24)18(25)33-8-10-2-4-11(5-3-10)22(26)27/h2-5,7,9,12,15H,6,8H2,1H3,(H,30,31,32)/t9-,12+,15-/m0/s1 |
| InChIKey | HSMNBWTUCXOATP-UAKXVISKSA-N |
| XLogP | 2.45 |
| TPSA | 209.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|