C23H29N5O6SSi — CID 154297397
(4-nitrophenyl)methyl (5R,6R)-3-(4-azidobut-2-en-2-ylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 154297397) has the molecular formula C23H29N5O6SSi and a molecular weight of 531.67 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6R)-3-(4-azidobut-2-en-2-ylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6R)-3-(4-azidobut-2-en-2-ylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 154297397 |
| Molecular Formula | C23H29N5O6SSi |
| Molecular Weight | 531.67 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6R)-3-(4-azidobut-2-en-2-ylsulfanyl)-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(=CCN=[N+]=[N-])SC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)[C@@H]([C@H](C)O[Si](C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C23H29N5O6SSi/c1-14(10-11-25-26-24)35-19-12-18-20(15(2)34-36(3,4)5)22(29)27(18)21(19)23(30)33-13-16-6-8-17(9-7-16)28(31)32/h6-10,15,18,20H,11-13H2,1-5H3/t15-,18+,20-/m0/s1 |
| InChIKey | MEHWWYJJQBMENV-CVAIRZPRSA-N |
| XLogP | 5.27 |
| TPSA | 147.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|