C23H30N6O6SSi — CID 56628369
(4-nitrophenyl)methyl (5R,6S)-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 56628369) has the molecular formula C23H30N6O6SSi and a molecular weight of 546.68 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 56628369 |
| Molecular Formula | C23H30N6O6SSi |
| Molecular Weight | 546.68 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-3-[2-(5-methyltetrazol-1-yl)ethylsulfanyl]-7-oxo-6-[(1S)-1-trimethylsilyloxyethyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | Cc1nnnn1CCSC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)[C@H]([C@H](C)O[Si](C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C23H30N6O6SSi/c1-14(35-37(3,4)5)20-18-12-19(36-11-10-27-15(2)24-25-26-27)21(28(18)22(20)30)23(31)34-13-16-6-8-17(9-7-16)29(32)33/h6-9,14,18,20H,10-13H2,1-5H3/t14-,18+,20+/m0/s1 |
| InChIKey | RMEVDVDAAQLCOD-BOUXLOLZSA-N |
| XLogP | 3.05 |
| TPSA | 142.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.68 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|