C27H28N4O10S — CID 56976747
sulfanyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[1-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 56976747) has the molecular formula C27H28N4O10S and a molecular weight of 600.61 g/mol. Its IUPAC name is sulfanyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[1-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | sulfanyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[1-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 56976747 |
| Molecular Formula | C27H28N4O10S |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | sulfanyl (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[1-[(4-nitrophenyl)methoxycarbonylamino]propyl]-4-[(4-nitrophenyl)methyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CCC(NC(=O)OCc1ccc([N+](=O)[O-])cc1)C1=C(C(=O)OS)N2C(=O)[C@H]([C@@H](C)O)[C@H]2C1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H28N4O10S/c1-3-20(28-27(35)40-13-16-6-10-18(11-7-16)31(38)39)22-19(12-15-4-8-17(9-5-15)30(36)37)23-21(14(2)32)25(33)29(23)24(22)26(34)41-42/h4-11,14,19-21,23,32,42H,3,12-13H2,1-2H3,(H,28,35)/t14-,19?,20?,21-,23-/m1/s1 |
| InChIKey | NFLLHKRRBVHHJS-OJGOBTSNSA-N |
| XLogP | 3.23 |
| TPSA | 191.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|