C19H21N3O8S2 — CID 18601945
(5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid (PubChem CID 18601945) has the molecular formula C19H21N3O8S2 and a molecular weight of 483.52 g/mol. Its IUPAC name is (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid.
| Compound Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 18601945 |
| Molecular Formula | C19H21N3O8S2 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | (5R,6S)-6-[(1R)-1-hydroxyethyl]-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(CSCCNC(=O)OCc3ccc([N+](=O)[O-])cc3)S[C@H]12 |
| InChI | InChI=1S/C19H21N3O8S2/c1-10(23)14-16(24)21-15(18(25)26)13(32-17(14)21)9-31-7-6-20-19(27)30-8-11-2-4-12(5-3-11)22(28)29/h2-5,10,14,17,23H,6-9H2,1H3,(H,20,27)(H,25,26)/t10-,14+,17-/m1/s1 |
| InChIKey | VNLNGFRHEFDXES-OVWKYPIYSA-N |
| XLogP | 1.76 |
| TPSA | 159.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|