C28H30N4O10S — CID 57008723
(4-nitrophenyl)methyl (5R,6S)-6-(2-hydroxypropan-2-yl)-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 57008723) has the molecular formula C28H30N4O10S and a molecular weight of 614.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6S)-6-(2-hydroxypropan-2-yl)-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6S)-6-(2-hydroxypropan-2-yl)-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 57008723 |
| Molecular Formula | C28H30N4O10S |
| Molecular Weight | 614.63 g/mol |
| Exact Mass | 614.17 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6S)-6-(2-hydroxypropan-2-yl)-3-[2-[(4-nitrophenyl)methoxycarbonylamino]ethylsulfanylmethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(C)(O)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=C(CSCCNC(=O)OCc3ccc([N+](=O)[O-])cc3)C[C@H]12 |
| InChI | InChI=1S/C28H30N4O10S/c1-28(2,36)23-22-13-19(16-43-12-11-29-27(35)42-15-18-5-9-21(10-6-18)32(39)40)24(30(22)25(23)33)26(34)41-14-17-3-7-20(8-4-17)31(37)38/h3-10,22-23,36H,11-16H2,1-2H3,(H,29,35)/t22-,23-/m1/s1 |
| InChIKey | RPCLIWNAKRLOSX-DHIUTWEWSA-N |
| XLogP | 3.46 |
| TPSA | 191.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|