C23H32N2O5S2Si — CID 139885432
O-[(4-nitrophenyl)methyl] (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate (PubChem CID 139885432) has the molecular formula C23H32N2O5S2Si and a molecular weight of 508.74 g/mol. Its IUPAC name is O-[(4-nitrophenyl)methyl] (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate.
| Compound Name | O-[(4-nitrophenyl)methyl] (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate |
|---|---|
| PubChem CID | 139885432 |
| Molecular Formula | C23H32N2O5S2Si |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | O-[(4-nitrophenyl)methyl] (5S,6S)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-3-ethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carbothioate |
| SMILES | CCC1=C(C(=S)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@@H]2S1 |
| InChI | InChI=1S/C23H32N2O5S2Si/c1-8-17-19(22(31)29-13-15-9-11-16(12-10-15)25(27)28)24-20(26)18(21(24)32-17)14(2)30-33(6,7)23(3,4)5/h9-12,14,18,21H,8,13H2,1-7H3/t14-,18+,21+/m1/s1 |
| InChIKey | KTFDAKUYFQFKKV-IBZMOEQTSA-N |
| XLogP | 6.00 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|