C24H34N2O6Si — CID 10552486
(4-nitrophenyl)methyl (7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate (PubChem CID 10552486) has the molecular formula C24H34N2O6Si and a molecular weight of 474.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate |
|---|---|
| PubChem CID | 10552486 |
| Molecular Formula | C24H34N2O6Si |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (4-nitrophenyl)methyl (7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)CC=CC[C@H]12 |
| InChI | InChI=1S/C24H34N2O6Si/c1-16(32-33(5,6)24(2,3)4)21-19-9-7-8-10-20(25(19)22(21)27)23(28)31-15-17-11-13-18(14-12-17)26(29)30/h7-8,11-14,16,19-21H,9-10,15H2,1-6H3/t16-,19-,20?,21-/m1/s1 |
| InChIKey | SCLLRJYPWOKSHV-XHMZRDMFSA-N |
| XLogP | 4.59 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|