C21H37NO4Si — CID 102461192
tert-butyl (2R,7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate (PubChem CID 102461192) has the molecular formula C21H37NO4Si and a molecular weight of 395.62 g/mol. Its IUPAC name is tert-butyl (2R,7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate.
| Compound Name | tert-butyl (2R,7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate |
|---|---|
| PubChem CID | 102461192 |
| Molecular Formula | C21H37NO4Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | tert-butyl (2R,7R,8S)-8-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-9-oxo-1-azabicyclo[5.2.0]non-4-ene-2-carboxylate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N2[C@@H](C(=O)OC(C)(C)C)CC=CC[C@H]12 |
| InChI | InChI=1S/C21H37NO4Si/c1-14(26-27(8,9)21(5,6)7)17-15-12-10-11-13-16(22(15)18(17)23)19(24)25-20(2,3)4/h10-11,14-17H,12-13H2,1-9H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | FSFADHJLRIJVHO-QBPKDAKJSA-N |
| XLogP | 4.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|