C13H25NO3Si — CID 141372311
1-acetyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one (PubChem CID 141372311) has the molecular formula C13H25NO3Si and a molecular weight of 271.43 g/mol. Its IUPAC name is 1-acetyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one.
| Compound Name | 1-acetyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 141372311 |
| Molecular Formula | C13H25NO3Si |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-acetyl-3-[1-[tert-butyl(dimethyl)silyl]oxyethyl]azetidin-2-one |
| SMILES | CC(=O)N1CC(C(C)O[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H25NO3Si/c1-9(17-18(6,7)13(3,4)5)11-8-14(10(2)15)12(11)16/h9,11H,8H2,1-7H3 |
| InChIKey | WXLDWWMGOLTXFQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|