C18H33NO4SSi — CID 44598755
methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 44598755) has the molecular formula C18H33NO4SSi and a molecular weight of 387.62 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 44598755 |
| Molecular Formula | C18H33NO4SSi |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | methyl 2-[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)C(=C(C)C)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SC |
| InChI | InChI=1S/C18H33NO4SSi/c1-11(2)14(17(21)22-7)19-15(20)13(16(19)24-8)12(3)23-25(9,10)18(4,5)6/h12-13,16H,1-10H3/t12-,13+,16-/m1/s1 |
| InChIKey | KPCSZGWWEBZSSY-DVOMOZLQSA-N |
| XLogP | 4.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|