C24H34N2O4S3Si — CID 44597026
methyl 2-[(2R,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 44597026) has the molecular formula C24H34N2O4S3Si and a molecular weight of 538.83 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[(2R,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 44597026 |
| Molecular Formula | C24H34N2O4S3Si |
| Molecular Weight | 538.83 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | methyl 2-[(2R,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)C(=C(C)C)N1C(=O)[C@H]([C@@H](C)O[Si](C)(C)C(C)(C)C)[C@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H34N2O4S3Si/c1-14(2)19(22(28)29-7)26-20(27)18(15(3)30-34(8,9)24(4,5)6)21(26)32-33-23-25-16-12-10-11-13-17(16)31-23/h10-13,15,18,21H,1-9H3/t15-,18+,21-/m1/s1 |
| InChIKey | CYKYIXVPTQTGRM-FYINFDKHSA-N |
| XLogP | 6.70 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.83 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|