C26H35Cl3N2O4S3Si — CID 87986488
2,2,2-trichloroethyl 2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 87986488) has the molecular formula C26H35Cl3N2O4S3Si and a molecular weight of 670.22 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | 2,2,2-trichloroethyl 2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 87986488 |
| Molecular Formula | C26H35Cl3N2O4S3Si |
| Molecular Weight | 670.22 g/mol |
| Exact Mass | 668.06 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[(2R,3R)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-[1-[tert-butyl(dimethyl)silyl]oxypropyl]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)[C@@H](C(CC)O[Si](C)(C)C(C)(C)C)[C@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C26H35Cl3N2O4S3Si/c1-9-17(35-39(7,8)25(4,5)6)19-21(32)31(20(15(2)3)23(33)34-14-26(27,28)29)22(19)37-38-24-30-16-12-10-11-13-18(16)36-24/h10-13,17,19-20,22H,2,9,14H2,1,3-8H3/t17?,19-,20?,22-/m1/s1 |
| InChIKey | PWVIZMUPTWNONW-HJSRJYPHSA-N |
| XLogP | 8.48 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.22 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|