C28H22Cl4N4O5S3 — CID 23345930
2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 23345930) has the molecular formula C28H22Cl4N4O5S3 and a molecular weight of 732.52 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | 2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 23345930 |
| Molecular Formula | C28H22Cl4N4O5S3 |
| Molecular Weight | 732.52 g/mol |
| Exact Mass | 729.95 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-3-[[3-(2-chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]amino]-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCC(Cl)(Cl)Cl)N1C(=O)C(NC(=O)c2c(-c3ccccc3Cl)noc2C)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C28H22Cl4N4O5S3/c1-13(2)22(26(39)40-12-28(30,31)32)36-24(38)21(25(36)43-44-27-33-17-10-6-7-11-18(17)42-27)34-23(37)19-14(3)41-35-20(19)15-8-4-5-9-16(15)29/h4-11,21-22,25H,1,12H2,2-3H3,(H,34,37) |
| InChIKey | JFIQRGUZIDPCDX-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.52 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|