C28H24N2O3S3 — CID 10816112
benzhydryl (2R)-2-[(2R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 10816112) has the molecular formula C28H24N2O3S3 and a molecular weight of 532.71 g/mol. Its IUPAC name is benzhydryl (2R)-2-[(2R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | benzhydryl (2R)-2-[(2R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 10816112 |
| Molecular Formula | C28H24N2O3S3 |
| Molecular Weight | 532.71 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | benzhydryl (2R)-2-[(2R)-2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)[C@H](C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)C[C@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C28H24N2O3S3/c1-18(2)25(27(32)33-26(19-11-5-3-6-12-19)20-13-7-4-8-14-20)30-23(31)17-24(30)35-36-28-29-21-15-9-10-16-22(21)34-28/h3-16,24-26H,1,17H2,2H3/t24-,25-/m1/s1 |
| InChIKey | LWPMPBXPAISDHI-JWQCQUIFSA-N |
| XLogP | 6.87 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.71 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|