C17H18N2O4S3 — CID 57193146
methyl 2-[(2S,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 57193146) has the molecular formula C17H18N2O4S3 and a molecular weight of 410.54 g/mol. Its IUPAC name is methyl 2-[(2S,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | methyl 2-[(2S,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 57193146 |
| Molecular Formula | C17H18N2O4S3 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | methyl 2-[(2S,3S)-2-(1,3-benzothiazol-2-yldisulfanyl)-3-methoxy-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)C(=C(C)C)N1C(=O)[C@H](OC)[C@@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C17H18N2O4S3/c1-9(2)12(16(21)23-4)19-14(20)13(22-3)15(19)25-26-17-18-10-7-5-6-8-11(10)24-17/h5-8,13,15H,1-4H3/t13-,15-/m0/s1 |
| InChIKey | GYQWXPRBGAJMJE-ZFWWWQNUSA-N |
| XLogP | 3.69 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|