C23H31N2O5S3Si — CID 88663169
CID 88663169 (PubChem CID 88663169) has the molecular formula C23H31N2O5S3Si and a molecular weight of 539.80 g/mol.
| Compound Name | CID 88663169 |
|---|---|
| PubChem CID | 88663169 |
| Molecular Formula | C23H31N2O5S3Si |
| Molecular Weight | 539.80 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | — |
| SMILES | COC(=O)/C(=C(/C)O)N1C(=O)C([C@@](C)(O[Si](C)C)C(C)(C)C)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H31N2O5S3Si/c1-13(26)17(20(28)29-6)25-18(27)16(23(5,22(2,3)4)30-34(7)8)19(25)32-33-21-24-14-11-9-10-12-15(14)31-21/h9-12,16,19,26H,1-8H3/b17-13+/t16?,19?,23-/m1/s1 |
| InChIKey | RVVXRXYPGFOQIB-IJTMJSKESA-N |
| XLogP | 5.86 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.80 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|