C23H29N2O5S3Si — CID 88643938
CID 88643938 (PubChem CID 88643938) has the molecular formula C23H29N2O5S3Si and a molecular weight of 537.78 g/mol.
| Compound Name | CID 88643938 |
|---|---|
| PubChem CID | 88643938 |
| Molecular Formula | C23H29N2O5S3Si |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | — |
| SMILES | C=CCOC(=O)C(=O)N1C(=O)[C@H]([C@@H](CO[Si](C)C)C(C)(C)C)[C@H]1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H29N2O5S3Si/c1-7-12-29-21(28)19(27)25-18(26)17(14(23(2,3)4)13-30-34(5)6)20(25)32-33-22-24-15-10-8-9-11-16(15)31-22/h7-11,14,17,20H,1,12-13H2,2-6H3/t14-,17+,20-/m1/s1 |
| InChIKey | KHHRKDXRZUWHAS-CFLQYTFWSA-N |
| XLogP | 5.01 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|