C24H25N3O7S3 — CID 88716645
2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3,3-dimethoxybutanoic acid (PubChem CID 88716645) has the molecular formula C24H25N3O7S3 and a molecular weight of 563.68 g/mol. Its IUPAC name is 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3,3-dimethoxybutanoic acid.
| Compound Name | 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3,3-dimethoxybutanoic acid |
|---|---|
| PubChem CID | 88716645 |
| Molecular Formula | C24H25N3O7S3 |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | 2-[2-(1,3-benzothiazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3,3-dimethoxybutanoic acid |
| SMILES | COC(C)(OC)C(C(=O)O)N1C(=O)C(NC(=O)COc2ccccc2)C1SSc1nc2ccccc2s1 |
| InChI | InChI=1S/C24H25N3O7S3/c1-24(32-2,33-3)19(22(30)31)27-20(29)18(26-17(28)13-34-14-9-5-4-6-10-14)21(27)36-37-23-25-15-11-7-8-12-16(15)35-23/h4-12,18-19,21H,13H2,1-3H3,(H,26,28)(H,30,31) |
| InChIKey | UTRHTAMXPPFFMP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|