C26H25N3O5S2 — CID 23049534
methyl 3-methyl-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-(quinolin-2-yldisulfanyl)azetidin-1-yl]but-3-enoate (PubChem CID 23049534) has the molecular formula C26H25N3O5S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is methyl 3-methyl-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-(quinolin-2-yldisulfanyl)azetidin-1-yl]but-3-enoate.
| Compound Name | methyl 3-methyl-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-(quinolin-2-yldisulfanyl)azetidin-1-yl]but-3-enoate |
|---|---|
| PubChem CID | 23049534 |
| Molecular Formula | C26H25N3O5S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | methyl 3-methyl-2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-(quinolin-2-yldisulfanyl)azetidin-1-yl]but-3-enoate |
| SMILES | C=C(C)C(C(=O)OC)N1C(=O)C(NC(=O)COc2ccccc2)C1SSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H25N3O5S2/c1-16(2)23(26(32)33-3)29-24(31)22(28-20(30)15-34-18-10-5-4-6-11-18)25(29)36-35-21-14-13-17-9-7-8-12-19(17)27-21/h4-14,22-23,25H,1,15H2,2-3H3,(H,28,30) |
| InChIKey | IBSOWNAWFRBRIV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|