C35H29N3O7S2 — CID 173435680
benzhydryl 2-[2-(1,3-benzoxazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 173435680) has the molecular formula C35H29N3O7S2 and a molecular weight of 667.77 g/mol. Its IUPAC name is benzhydryl 2-[2-(1,3-benzoxazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | benzhydryl 2-[2-(1,3-benzoxazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 173435680 |
| Molecular Formula | C35H29N3O7S2 |
| Molecular Weight | 667.77 g/mol |
| Exact Mass | 667.14 |
| IUPAC Name | benzhydryl 2-[2-(1,3-benzoxazol-2-yldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | CC(O)=C(C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)C(NC(=O)COc2ccccc2)C1SSc1nc2ccccc2o1 |
| InChI | InChI=1S/C35H29N3O7S2/c1-22(39)30(34(42)45-31(23-13-5-2-6-14-23)24-15-7-3-8-16-24)38-32(41)29(37-28(40)21-43-25-17-9-4-10-18-25)33(38)46-47-35-36-26-19-11-12-20-27(26)44-35/h2-20,29,31,33,39H,21H2,1H3,(H,37,40) |
| InChIKey | WVMYCJFNMCSSIM-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|