C30H30N2O8S2 — CID 54185115
benzyl 3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate (PubChem CID 54185115) has the molecular formula C30H30N2O8S2 and a molecular weight of 610.71 g/mol. Its IUPAC name is benzyl 3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate.
| Compound Name | benzyl 3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 54185115 |
| Molecular Formula | C30H30N2O8S2 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | benzyl 3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
| SMILES | COC(C)=C(C(=O)OCc1ccccc1)N1C(=O)C(NC(=O)COc2ccccc2)C1SS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H30N2O8S2/c1-20-14-16-24(17-15-20)42(36,37)41-29-26(31-25(33)19-39-23-12-8-5-9-13-23)28(34)32(29)27(21(2)38-3)30(35)40-18-22-10-6-4-7-11-22/h4-17,26,29H,18-19H2,1-3H3,(H,31,33) |
| InChIKey | PEOJVMYIWNQCOW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|