C41H43N3O9S2 — CID 70558045
benzhydryl (E)-3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]-4-oxoazetidin-1-yl]but-2-enoate (PubChem CID 70558045) has the molecular formula C41H43N3O9S2 and a molecular weight of 785.94 g/mol. Its IUPAC name is benzhydryl (E)-3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]-4-oxoazetidin-1-yl]but-2-enoate.
| Compound Name | benzhydryl (E)-3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]-4-oxoazetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 70558045 |
| Molecular Formula | C41H43N3O9S2 |
| Molecular Weight | 785.94 g/mol |
| Exact Mass | 785.24 |
| IUPAC Name | benzhydryl (E)-3-methoxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-3-[[2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylacetyl]amino]-4-oxoazetidin-1-yl]but-2-enoate |
| SMILES | CO/C(C)=C(\C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)C(NC(=O)C(NC(=O)OC(C)(C)C)c2ccccc2)C1SS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C41H43N3O9S2/c1-26-22-24-31(25-23-26)55(49,50)54-38-33(42-36(45)32(28-16-10-7-11-17-28)43-40(48)53-41(3,4)5)37(46)44(38)34(27(2)51-6)39(47)52-35(29-18-12-8-13-19-29)30-20-14-9-15-21-30/h7-25,32-33,35,38H,1-6H3,(H,42,45)(H,43,48)/b34-27+ |
| InChIKey | WBGCUUZDALVFDM-DNGXXSEMSA-N |
| XLogP | 6.55 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.94 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|