C35H31FN2O10S3 — CID 57200063
benzhydryl 3-fluorosulfonyloxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate (PubChem CID 57200063) has the molecular formula C35H31FN2O10S3 and a molecular weight of 754.84 g/mol. Its IUPAC name is benzhydryl 3-fluorosulfonyloxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate.
| Compound Name | benzhydryl 3-fluorosulfonyloxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 57200063 |
| Molecular Formula | C35H31FN2O10S3 |
| Molecular Weight | 754.84 g/mol |
| Exact Mass | 754.11 |
| IUPAC Name | benzhydryl 3-fluorosulfonyloxy-2-[2-(4-methylphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
| SMILES | CC(OS(=O)(=O)F)=C(C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)C(NC(=O)COc2ccccc2)C1SS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C35H31FN2O10S3/c1-23-18-20-28(21-19-23)50(42,43)49-34-30(37-29(39)22-46-27-16-10-5-11-17-27)33(40)38(34)31(24(2)48-51(36,44)45)35(41)47-32(25-12-6-3-7-13-25)26-14-8-4-9-15-26/h3-21,30,32,34H,22H2,1-2H3,(H,37,39) |
| InChIKey | GOZONMGLZMEDIM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.84 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|