C19H19Cl3N2O7S2 — CID 88808443
2,2,2-trichloroethyl 2-[2-(acetyldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 88808443) has the molecular formula C19H19Cl3N2O7S2 and a molecular weight of 557.86 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-[2-(acetyldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | 2,2,2-trichloroethyl 2-[2-(acetyldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88808443 |
| Molecular Formula | C19H19Cl3N2O7S2 |
| Molecular Weight | 557.86 g/mol |
| Exact Mass | 555.97 |
| IUPAC Name | 2,2,2-trichloroethyl 2-[2-(acetyldisulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | CC(=O)SSC1C(NC(=O)COc2ccccc2)C(=O)N1C(C(=O)OCC(Cl)(Cl)Cl)=C(C)O |
| InChI | InChI=1S/C19H19Cl3N2O7S2/c1-10(25)15(18(29)31-9-19(20,21)22)24-16(28)14(17(24)33-32-11(2)26)23-13(27)8-30-12-6-4-3-5-7-12/h3-7,14,17,25H,8-9H2,1-2H3,(H,23,27) |
| InChIKey | OQTJZHHJBRHZMX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|