C33H34N2O9 — CID 12961437
benzyl 3-methyl-2-[(3S,4S)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2-phenoxyacetyl)oxyethoxy]azetidin-1-yl]but-2-enoate (PubChem CID 12961437) has the molecular formula C33H34N2O9 and a molecular weight of 602.64 g/mol. Its IUPAC name is benzyl 3-methyl-2-[(3S,4S)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2-phenoxyacetyl)oxyethoxy]azetidin-1-yl]but-2-enoate.
| Compound Name | benzyl 3-methyl-2-[(3S,4S)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2-phenoxyacetyl)oxyethoxy]azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 12961437 |
| Molecular Formula | C33H34N2O9 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | benzyl 3-methyl-2-[(3S,4S)-2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2-phenoxyacetyl)oxyethoxy]azetidin-1-yl]but-2-enoate |
| SMILES | CC(C)=C(C(=O)OCc1ccccc1)N1C(=O)[C@@H](NC(=O)COc2ccccc2)[C@@H]1OCCOC(=O)COc1ccccc1 |
| InChI | InChI=1S/C33H34N2O9/c1-23(2)30(33(39)44-20-24-12-6-3-7-13-24)35-31(38)29(34-27(36)21-42-25-14-8-4-9-15-25)32(35)41-19-18-40-28(37)22-43-26-16-10-5-11-17-26/h3-17,29,32H,18-22H2,1-2H3,(H,34,36)/t29-,32+/m1/s1 |
| InChIKey | HRSLVHHZFMILMI-PPTMTGTBSA-N |
| XLogP | 3.39 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|