C32H30N2O5 — CID 88677106
benzhydryl 3-methyl-2-[(3R,4S)-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]but-2-enoate (PubChem CID 88677106) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is benzhydryl 3-methyl-2-[(3R,4S)-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]but-2-enoate.
| Compound Name | benzhydryl 3-methyl-2-[(3R,4S)-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 88677106 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | benzhydryl 3-methyl-2-[(3R,4S)-2-oxo-3-[(2-phenylacetyl)amino]-4-prop-2-ynoxyazetidin-1-yl]but-2-enoate |
| SMILES | C#CCO[C@H]1[C@@H](NC(=O)Cc2ccccc2)C(=O)N1C(C(=O)OC(c1ccccc1)c1ccccc1)=C(C)C |
| InChI | InChI=1S/C32H30N2O5/c1-4-20-38-31-27(33-26(35)21-23-14-8-5-9-15-23)30(36)34(31)28(22(2)3)32(37)39-29(24-16-10-6-11-17-24)25-18-12-7-13-19-25/h1,5-19,27,29,31H,20-21H2,2-3H3,(H,33,35)/t27-,31-/m0/s1 |
| InChIKey | DKXQUJPUHXUQGP-DHIFEGFHSA-N |
| XLogP | 4.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|