C36H42N2O7 — CID 70564497
benzhydryl 2-[(2S,3R)-2-(2,2-diethoxypropoxy)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 70564497) has the molecular formula C36H42N2O7 and a molecular weight of 614.74 g/mol. Its IUPAC name is benzhydryl 2-[(2S,3R)-2-(2,2-diethoxypropoxy)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzhydryl 2-[(2S,3R)-2-(2,2-diethoxypropoxy)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 70564497 |
| Molecular Formula | C36H42N2O7 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.30 |
| IUPAC Name | benzhydryl 2-[(2S,3R)-2-(2,2-diethoxypropoxy)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CCOC(C)(CO[C@H]1[C@@H](NC(=O)Cc2ccccc2)C(=O)N1C(C(=O)OC(c1ccccc1)c1ccccc1)=C(C)C)OCC |
| InChI | InChI=1S/C36H42N2O7/c1-6-43-36(5,44-7-2)24-42-34-30(37-29(39)23-26-17-11-8-12-18-26)33(40)38(34)31(25(3)4)35(41)45-32(27-19-13-9-14-20-27)28-21-15-10-16-22-28/h8-22,30,32,34H,6-7,23-24H2,1-5H3,(H,37,39)/t30-,34-/m0/s1 |
| InChIKey | WKKMBCJVEUTMQG-NHZFLZHXSA-N |
| XLogP | 5.31 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|