C24H22Cl4N2O5 — CID 22788798
benzhydryl 2-[(3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 22788798) has the molecular formula C24H22Cl4N2O5 and a molecular weight of 560.26 g/mol. Its IUPAC name is benzhydryl 2-[(3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzhydryl 2-[(3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 22788798 |
| Molecular Formula | C24H22Cl4N2O5 |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 558.03 |
| IUPAC Name | benzhydryl 2-[(3S)-2-chloro-4-oxo-3-(2,2,2-trichloroethoxycarbonylamino)azetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)[C@H](NC(=O)OCC(Cl)(Cl)Cl)C1Cl |
| InChI | InChI=1S/C24H22Cl4N2O5/c1-14(2)18(30-20(25)17(21(30)31)29-23(33)34-13-24(26,27)28)22(32)35-19(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,19-20H,13H2,1-2H3,(H,29,33)/t17-,20?/m1/s1 |
| InChIKey | XUVKAPRJPWDRLW-DIAVIDTQSA-N |
| XLogP | 5.49 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|