C22H24N2O3S — CID 22807044
benzhydryl 2-[(2R,3R)-3-amino-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 22807044) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is benzhydryl 2-[(2R,3R)-3-amino-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzhydryl 2-[(2R,3R)-3-amino-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 22807044 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | benzhydryl 2-[(2R,3R)-3-amino-2-methylsulfanyl-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CS[C@@H]1[C@H](N)C(=O)N1C(C(=O)OC(c1ccccc1)c1ccccc1)=C(C)C |
| InChI | InChI=1S/C22H24N2O3S/c1-14(2)18(24-20(25)17(23)21(24)28-3)22(26)27-19(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17,19,21H,23H2,1-3H3/t17-,21-/m1/s1 |
| InChIKey | DGSODMFZXNAQSR-DYESRHJHSA-N |
| XLogP | 3.47 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|