C21H21BrN2O3 — CID 70595033
benzhydryl (Z)-2-(3-amino-2-oxoazetidin-1-yl)-4-bromo-3-methylbut-2-enoate (PubChem CID 70595033) has the molecular formula C21H21BrN2O3 and a molecular weight of 429.31 g/mol. Its IUPAC name is benzhydryl (Z)-2-(3-amino-2-oxoazetidin-1-yl)-4-bromo-3-methylbut-2-enoate.
| Compound Name | benzhydryl (Z)-2-(3-amino-2-oxoazetidin-1-yl)-4-bromo-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 70595033 |
| Molecular Formula | C21H21BrN2O3 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | benzhydryl (Z)-2-(3-amino-2-oxoazetidin-1-yl)-4-bromo-3-methylbut-2-enoate |
| SMILES | C/C(CBr)=C(\C(=O)OC(c1ccccc1)c1ccccc1)N1CC(N)C1=O |
| InChI | InChI=1S/C21H21BrN2O3/c1-14(12-22)18(24-13-17(23)20(24)25)21(26)27-19(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,17,19H,12-13,23H2,1H3/b18-14- |
| InChIKey | XEWBJFMACPANKY-JXAWBTAJSA-N |
| XLogP | 3.16 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|