C21H21ClN2O3 — CID 22796574
benzhydryl 2-[(2R,3S)-3-amino-2-chloro-4-oxoazetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 22796574) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is benzhydryl 2-[(2R,3S)-3-amino-2-chloro-4-oxoazetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzhydryl 2-[(2R,3S)-3-amino-2-chloro-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 22796574 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | benzhydryl 2-[(2R,3S)-3-amino-2-chloro-4-oxoazetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)[C@H](N)[C@H]1Cl |
| InChI | InChI=1S/C21H21ClN2O3/c1-13(2)17(24-19(22)16(23)20(24)25)21(26)27-18(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16,18-19H,23H2,1-2H3/t16-,19+/m1/s1 |
| InChIKey | AZFGHANBCLKWEE-APWZRJJASA-N |
| XLogP | 3.35 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|