C29H29ClN2O4 — CID 70592720
benzhydryl 2-[2-chloro-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate (PubChem CID 70592720) has the molecular formula C29H29ClN2O4 and a molecular weight of 505.01 g/mol. Its IUPAC name is benzhydryl 2-[2-chloro-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate.
| Compound Name | benzhydryl 2-[2-chloro-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 70592720 |
| Molecular Formula | C29H29ClN2O4 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | benzhydryl 2-[2-chloro-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-3-methylbut-2-enoate |
| SMILES | CC(C)=C(C(=O)OC(c1ccccc1)c1ccccc1)N1CC(NC(=O)COc2ccccc2)C1Cl |
| InChI | InChI=1S/C29H29ClN2O4/c1-20(2)26(29(34)36-27(21-12-6-3-7-13-21)22-14-8-4-9-15-22)32-18-24(28(32)30)31-25(33)19-35-23-16-10-5-11-17-23/h3-17,24,27-28H,18-19H2,1-2H3,(H,31,33) |
| InChIKey | JNHOHWAYXYPPNH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|