C36H34N2O9S2 — CID 70559729
benzhydryl (E)-3-methoxy-2-[2-(2-methoxyphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate (PubChem CID 70559729) has the molecular formula C36H34N2O9S2 and a molecular weight of 702.81 g/mol. Its IUPAC name is benzhydryl (E)-3-methoxy-2-[2-(2-methoxyphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate.
| Compound Name | benzhydryl (E)-3-methoxy-2-[2-(2-methoxyphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 70559729 |
| Molecular Formula | C36H34N2O9S2 |
| Molecular Weight | 702.81 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | benzhydryl (E)-3-methoxy-2-[2-(2-methoxyphenyl)sulfonylsulfanyl-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]but-2-enoate |
| SMILES | CO/C(C)=C(\C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)C(NC(=O)COc2ccccc2)C1SS(=O)(=O)c1ccccc1OC |
| InChI | InChI=1S/C36H34N2O9S2/c1-24(44-2)32(36(41)47-33(25-15-7-4-8-16-25)26-17-9-5-10-18-26)38-34(40)31(37-30(39)23-46-27-19-11-6-12-20-27)35(38)48-49(42,43)29-22-14-13-21-28(29)45-3/h4-22,31,33,35H,23H2,1-3H3,(H,37,39)/b32-24+ |
| InChIKey | NGLVXYYCQYRADZ-FEZSWGLMSA-N |
| XLogP | 5.06 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.81 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|