C21H26N2O7S — CID 88750829
tert-butyl 2-[(2R,3R)-2-(2-methylpropanoylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-oxoacetate (PubChem CID 88750829) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is tert-butyl 2-[(2R,3R)-2-(2-methylpropanoylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-oxoacetate.
| Compound Name | tert-butyl 2-[(2R,3R)-2-(2-methylpropanoylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 88750829 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | tert-butyl 2-[(2R,3R)-2-(2-methylpropanoylsulfanyl)-4-oxo-3-[(2-phenoxyacetyl)amino]azetidin-1-yl]-2-oxoacetate |
| SMILES | CC(C)C(=O)S[C@@H]1[C@H](NC(=O)COc2ccccc2)C(=O)N1C(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H26N2O7S/c1-12(2)20(28)31-18-15(22-14(24)11-29-13-9-7-6-8-10-13)16(25)23(18)17(26)19(27)30-21(3,4)5/h6-10,12,15,18H,11H2,1-5H3,(H,22,24)/t15-,18-/m1/s1 |
| InChIKey | JRNYLXCHWPDRJF-CRAIPNDOSA-N |
| XLogP | 1.50 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|