C43H36Cl3N2O9PS — CID 20530279
benzyl 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate (PubChem CID 20530279) has the molecular formula C43H36Cl3N2O9PS and a molecular weight of 894.17 g/mol. Its IUPAC name is benzyl 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate.
| Compound Name | benzyl 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
|---|---|
| PubChem CID | 20530279 |
| Molecular Formula | C43H36Cl3N2O9PS |
| Molecular Weight | 894.17 g/mol |
| Exact Mass | 892.09 |
| IUPAC Name | benzyl 2-[2-oxo-3-[(2-phenoxyacetyl)amino]-4-[2-(2,2,2-trichloroethoxycarbonyloxy)acetyl]sulfanylazetidin-1-yl]-2-(triphenyl-λ5-phosphanylidene)acetate |
| SMILES | O=C(COc1ccccc1)NC1C(=O)N(C(C(=O)OCc2ccccc2)=P(c2ccccc2)(c2ccccc2)c2ccccc2)C1SC(=O)COC(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C43H36Cl3N2O9PS/c44-43(45,46)29-57-42(53)56-28-36(50)59-40-37(47-35(49)27-54-31-18-8-2-9-19-31)38(51)48(40)39(41(52)55-26-30-16-6-1-7-17-30)58(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-25,37,40H,26-29H2,(H,47,49) |
| InChIKey | HXBHXCCYQZAWEA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.17 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|